119085-63-1 Usage
Uses
Used in Pharmaceutical Industry:
(2-Fluoro-4,5-dimethoxyphenyl)-(R)-hydroxyacetonitrile is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the creation of enantioenriched compounds. This property is crucial in ensuring the desired biological activity and reducing potential side effects associated with the less active enantiomer.
Used in Organic Synthesis:
In the field of organic synthesis, (2-Fluoro-4,5-dimethoxyphenyl)-(R)-hydroxyacetonitrile serves as a key building block for the development of new organic compounds. Its unique structure allows for further functionalization and modification, leading to the formation of a wide range of molecules with diverse properties and applications.
Used in Drug Development:
(2-Fluoro-4,5-dimethoxyphenyl)-(R)-hydroxyacetonitrile is utilized in drug development for its potential to contribute to the discovery and design of new drug molecules. Its incorporation into drug candidates can lead to improved pharmacological properties, such as enhanced potency, selectivity, and reduced toxicity.
Overall, (2-Fluoro-4,5-dimethoxyphenyl)-(R)-hydroxyacetonitrile is a multifaceted chemical compound with significant applications across various industries, particularly in the pharmaceutical sector, where its unique properties and potential for enantioselective synthesis make it an invaluable asset.
Check Digit Verification of cas no
The CAS Registry Mumber 119085-63-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,0,8 and 5 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 119085-63:
(8*1)+(7*1)+(6*9)+(5*0)+(4*8)+(3*5)+(2*6)+(1*3)=131
131 % 10 = 1
So 119085-63-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H10FNO3/c1-14-9-3-6(8(13)5-12)7(11)4-10(9)15-2/h3-4,8,13H,1-2H3/t8-/m0/s1
119085-63-1Relevant academic research and scientific papers
Substituted tetrahydroisoquinoline compounds and composition containing them
-
, (2008/06/13)
A compound of the formula (I) or its salt and a process for producing the compounds; The compounds have the effect to dilate neophrovascular tracts; STR1 wherein STR2 represents the formula STR3 (wherein R4 is a hydrogen atom or lower alkylsulf
