1192-59-2 Usage
Uses
Used in Pharmaceutical Industry:
4,5-Dihydro-2-methyl-1-vinyl-1H-imidazole is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4,5-Dihydro-2-methyl-1-vinyl-1H-imidazole is employed as a precursor in the production of agrochemicals, contributing to the development of effective pesticides and other agricultural chemicals.
Used in Specialty Chemicals Production:
4,5-Dihydro-2-methyl-1-vinyl-1H-imidazole is used as a building block for the synthesis of specialty chemicals, which have specific applications in various industries due to their unique chemical properties.
Used in Heterocyclic Compounds Synthesis:
As a reagent, 4,5-Dihydro-2-methyl-1-vinyl-1H-imidazole is utilized in the synthesis of heterocyclic compounds, which are important in various chemical and pharmaceutical applications.
Used as a Ligand in Coordination Chemistry:
4,5-Dihydro-2-methyl-1-vinyl-1H-imidazole serves as a ligand in coordination chemistry, playing a crucial role in the formation of coordination compounds with specific properties and applications.
Used in Polymerization Reactions:
4,5-Dihydro-2-methyl-1-vinyl-1H-imidazole is also used in polymerization reactions to produce polymers with unique properties, which can be applied in various industries, including materials science and engineering.
Used in Dyes and Pigments Production:
4,5-Dihydro-2-methyl-1-vinyl-1H-imidazole finds application in the production of dyes and pigments, where its chemical structure contributes to the color and stability of these products.
Used in Materials and Adhesives Manufacturing:
Furthermore, it is utilized in the manufacture of materials and adhesives, where its unique properties can enhance the performance and characteristics of these products.
Check Digit Verification of cas no
The CAS Registry Mumber 1192-59-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 2 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1192-59:
(6*1)+(5*1)+(4*9)+(3*2)+(2*5)+(1*9)=72
72 % 10 = 2
So 1192-59-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2/c1-3-8-5-4-7-6(8)2/h3H,1,4-5H2,2H3