119267-79-7 Usage
Uses
Used in Pharmaceutical Industry:
2-BROMO-1-(4-CHLOROPHENYL)-2-(4-METHYLPHENYL)ETHAN-1-ONE is used as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to react with other molecules to form new therapeutic agents. Its unique structure allows for the creation of diverse drug candidates with potential applications in treating a wide range of medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 2-BROMO-1-(4-CHLOROPHENYL)-2-(4-METHYLPHENYL)ETHAN-1-ONE is utilized as a precursor in the development of novel agrochemicals, such as pesticides and herbicides. Its chemical properties enable the production of effective compounds that can protect crops from pests and enhance agricultural productivity.
Used in Organic Synthesis:
2-BROMO-1-(4-CHLOROPHENYL)-2-(4-METHYLPHENYL)ETHAN-1-ONE is employed as a versatile building block in organic synthesis for its potential to participate in various chemical reactions, leading to the formation of a broad spectrum of organic compounds with different applications in industries such as materials science, fragrances, and dyes. Its reactivity and structural features make it a valuable component in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 119267-79-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,2,6 and 7 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 119267-79:
(8*1)+(7*1)+(6*9)+(5*2)+(4*6)+(3*7)+(2*7)+(1*9)=147
147 % 10 = 7
So 119267-79-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H12BrClO/c1-10-2-4-11(5-3-10)14(16)15(18)12-6-8-13(17)9-7-12/h2-9,14H,1H3
C:Corrosive;
