1193-23-3 Usage
Uses
Used in Pharmaceutical Synthesis:
4(1H)-Pyrimidinethione, 6-amino(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of drugs with antimicrobial, antiviral, and anticancer properties. Its unique structure allows for the creation of compounds that can target specific biological pathways, making it a valuable component in medicinal chemistry.
Used in Agrochemical Development:
In the agrochemical industry, 4(1H)-Pyrimidinethione, 6-amino(9CI) serves as a crucial building block for the synthesis of compounds with pesticidal properties, leveraging its antimicrobial characteristics to control or prevent crop diseases and pests.
Used in Medicinal Chemistry Research:
4(1H)-Pyrimidinethione, 6-amino(9CI) is utilized as a research compound in medicinal chemistry to explore its potential in drug development. Its diverse pharmacological properties make it an attractive candidate for designing new therapeutic agents that could address unmet medical needs.
Used in Organic Synthesis:
As a building block in organic synthesis, 4(1H)-Pyrimidinethione, 6-amino(9CI) is used for the preparation of a variety of functionalized compounds. Its reactivity and structural features facilitate the creation of complex organic molecules for various applications in material science, chemical research, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 1193-23-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 3 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1193-23:
(6*1)+(5*1)+(4*9)+(3*3)+(2*2)+(1*3)=63
63 % 10 = 3
So 1193-23-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H5N3S/c5-3-1-4(8)7-2-6-3/h1-2H,(H3,5,6,7,8)
