119305-41-8 Usage
General Description
1,3-dipropyl-8-(isothiocyanatophenyl(aminothiocarbonyl-(2-aminoethylaminocarbonyl-(4-methyloxy(phenyl)))))xanthine is a complex chemical compound with a xanthine core structure. It contains multiple functional groups, including isothiocyanate, phenyl, amino, and methyloxy groups. As a xanthine derivative, it may have potential pharmacological properties, such as acting as a central nervous system stimulant or bronchodilator. The compound's intricate structure suggests possible interactions with various biological targets, making it a subject of interest in medicinal chemistry and drug development. However, its specific biological activities and potential applications would require further investigation and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 119305-41-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,3,0 and 5 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 119305-41:
(8*1)+(7*1)+(6*9)+(5*3)+(4*0)+(3*5)+(2*4)+(1*1)=108
108 % 10 = 8
So 119305-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C29H32N8O5S2/c1-3-14-36-26-24(27(39)37(15-4-2)29(36)41)33-25(34-26)19-8-10-22(11-9-19)42-17-23(38)30-12-13-31-28(40)44-35-21-7-5-6-20(16-21)32-18-43/h5-11,16,35H,3-4,12-15,17H2,1-2H3,(H,30,38)(H,31,40)(H,33,34)