119396-88-2 Usage
Uses
Used in Pharmaceutical Industry:
4,5-DIMETHOXY-2-FLUOROBENZONITRILE is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs with improved therapeutic properties. Its unique structure allows for the creation of molecules with specific biological activities, enhancing the effectiveness of medications.
Used in Agrochemical Industry:
In the agrochemical sector, 4,5-DIMETHOXY-2-FLUOROBENZONITRILE serves as an essential intermediate in the production of agrochemicals, such as pesticides and herbicides. Its incorporation into these compounds can lead to the development of more effective and targeted agricultural products, contributing to increased crop yields and protection against pests.
Used in Material Science:
4,5-DIMETHOXY-2-FLUOROBENZONITRILE is utilized in material science as a building block for the development of new materials. Its unique chemical structure allows for the creation of novel materials with specific properties, such as improved stability, reactivity, or selectivity, which can be applied in various industries, including electronics, coatings, and plastics.
Used in Organic Synthesis Research:
As a chemical compound with distinctive properties, 4,5-DIMETHOXY-2-FLUOROBENZONITRILE is employed in organic synthesis research to explore new reaction pathways and develop innovative synthetic methods. Its use in research facilitates the discovery of new compounds and the optimization of existing synthetic routes, driving advancements in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 119396-88-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,3,9 and 6 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 119396-88:
(8*1)+(7*1)+(6*9)+(5*3)+(4*9)+(3*6)+(2*8)+(1*8)=162
162 % 10 = 2
So 119396-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8FNO2/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-4H,1-2H3
