1194-63-4 Usage
Uses
Used in Pharmaceutical Research:
Pyrazolo[1,5-a]pyrimidin-7-amine is utilized as a key building block in the synthesis of various bioactive compounds for pharmaceutical applications. Its unique structure allows for the creation of new drugs and therapeutics that can address a multitude of medical conditions.
Used in Drug Development:
In the field of drug development, Pyrazolo[1,5-a]pyrimidin-7-amine serves as a crucial component in the design and synthesis of novel pharmaceutical agents. Its incorporation into drug molecules can potentially enhance their efficacy, selectivity, and pharmacokinetic properties, leading to improved treatment options for patients.
Used in Medicinal Chemistry:
Pyrazolo[1,5-a]pyrimidin-7-amine is employed as a versatile scaffold in medicinal chemistry for the exploration of its potential interactions with biological targets. This can lead to the discovery of new lead compounds and the optimization of drug candidates for various therapeutic areas.
Further research and studies are essential to fully understand the potential uses and effects of Pyrazolo[1,5-a]pyrimidin-7-amine in medicine and drug development, ensuring its optimal application in creating effective and safe therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 1194-63-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 4 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 1194-63:
(6*1)+(5*1)+(4*9)+(3*4)+(2*6)+(1*3)=74
74 % 10 = 4
So 1194-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-5-1-3-8-6-2-4-9-10(5)6/h1-4H,7H2
1194-63-4Relevant academic research and scientific papers
Pyrazolo?1,5-a!pyrimidine derivative
-
, (2008/06/13)
The invention provides a pyrazolo?1,5-a!pyrimidine derivative of the following formula (1): STR1 wherein R1, R3, R4, R5, R6, Q, A and n are defined in the description; and R2 is naphthyl, c
