119452-65-2 Usage
Uses
Used in Pharmaceutical Industry:
Hydrazine, (2-chloro-4-fluorophenyl)(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to form a wide range of chemical bonds and reactions. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Chemical Synthesis:
In the field of organic chemistry, Hydrazine, (2-chloro-4-fluorophenyl)(9CI) serves as a valuable building block for the synthesis of complex organic molecules. Its reactivity enables the formation of various functional groups and the construction of molecular frameworks, contributing to the advancement of organic chemistry and the discovery of new compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 119452-65-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,4,5 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 119452-65:
(8*1)+(7*1)+(6*9)+(5*4)+(4*5)+(3*2)+(2*6)+(1*5)=132
132 % 10 = 2
So 119452-65-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H6ClFN2/c7-5-3-4(8)1-2-6(5)10-9/h1-3,10H,9H2
