1196151-72-0 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is used as a key intermediate in the synthesis of various pharmaceuticals for its diverse range of biological activities. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its biological properties contribute to the development of effective and targeted agrochemicals for crop protection and management.
Used in Drug Discovery and Development:
Ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate serves as a valuable building block in drug discovery and development due to its unique structure and biological properties. Researchers can use ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate to design and synthesize new drugs with potential therapeutic effects, enhancing the development of novel treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 1196151-72-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,9,6,1,5 and 1 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1196151-72:
(9*1)+(8*1)+(7*9)+(6*6)+(5*1)+(4*5)+(3*1)+(2*7)+(1*2)=160
160 % 10 = 0
So 1196151-72-0 is a valid CAS Registry Number.
InChI:InChI=1S/C10H9ClN2O2/c1-2-15-10(14)8-5-6-7(11)3-4-12-9(6)13-8/h3-5H,2H2,1H3,(H,12,13)
