119778-64-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Cyclopropyl-quinoline-4-carboxylic acid is used as a pharmaceutical intermediate for the development of new drugs, particularly in the areas of anti-inflammatory and anti-cancer therapies. Its potential pharmacological activities make it a valuable compound for the creation of novel therapeutic agents.
Used in Medicinal Chemistry Research:
2-Cyclopropyl-quinoline-4-carboxylic acid serves as a key subject in medicinal chemistry research, where its structure and properties are studied to understand its potential therapeutic uses and mechanisms of action. This research aims to identify new drug candidates and optimize their efficacy and safety profiles.
Used in Drug Development:
2-Cyclopropyl-quinoline-4-carboxylic acid is utilized in drug development as a starting material or a building block for the synthesis of more complex molecules with enhanced pharmacological properties. Its unique structure allows for the design of innovative drugs with improved efficacy and reduced side effects.
Used in Anti-inflammatory Applications:
2-Cyclopropyl-quinoline-4-carboxylic acid is employed as an anti-inflammatory agent, targeting the underlying causes of inflammation and reducing the associated symptoms. Its potential to modulate inflammatory pathways makes it a promising candidate for the treatment of various inflammatory disorders.
Used in Anti-cancer Applications:
2-Cyclopropyl-quinoline-4-carboxylic acid is used as an anti-cancer agent, exhibiting potential to inhibit the growth and proliferation of cancer cells. Its ability to target specific molecular pathways involved in cancer progression makes it a valuable compound for the development of targeted cancer therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 119778-64-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,9,7,7 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 119778-64:
(8*1)+(7*1)+(6*9)+(5*7)+(4*7)+(3*8)+(2*6)+(1*4)=172
172 % 10 = 2
So 119778-64-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H11NO2/c15-13(16)10-7-12(8-5-6-8)14-11-4-2-1-3-9(10)11/h1-4,7-8H,5-6H2,(H,15,16)/p-1
