1198396-29-0 Usage
Uses
Used in Organic Chemistry Research:
9-bromine-11,11-dimethyl-11H-benzo[a]fluorene is used as a building block for the synthesis of organic molecules and polymers due to its unique structure and reactivity. It contributes to the development of new compounds with potential applications in various fields.
Used in Material Science:
In the field of material science, 9-bromine-11,11-dimethyl-11H-benzo[a]fluorene is utilized for the preparation of advanced materials. Its structural features and reactivity make it a valuable component in creating materials with specific properties for various applications.
Used in Industrial Applications:
9-bromine-11,11-dimethyl-11H-benzo[a]fluorene is employed in industrial processes as a precursor or intermediate in the production of various organic compounds. Its unique structure allows for the creation of compounds with tailored properties for specific uses in industry.
Used in Academic Research:
In academic research, 9-bromine-11,11-dimethyl-11H-benzo[a]fluorene serves as a valuable tool for understanding the reactivity and behavior of polycyclic aromatic hydrocarbons in chemical and biological systems. This knowledge can be applied to further advancements in chemistry and related fields.
Check Digit Verification of cas no
The CAS Registry Mumber 1198396-29-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,9,8,3,9 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1198396-29:
(9*1)+(8*1)+(7*9)+(6*8)+(5*3)+(4*9)+(3*6)+(2*2)+(1*9)=210
210 % 10 = 0
So 1198396-29-0 is a valid CAS Registry Number.
InChI:InChI=1S/C19H15Br/c1-19(2)17-11-13(20)8-10-15(17)16-9-7-12-5-3-4-6-14(12)18(16)19/h3-11H,1-2H3
