1198396-29-0 Usage
General Description
9-bromine-11,11-dimethyl-11H-benzo[a]fluorene is a chemical compound with the molecular formula C21H17Br. It is a derivative of benzo[a]fluorene, a polycyclic aromatic hydrocarbon, and contains a bromine atom and two methyl groups attached to the benzo[a]fluorene structure. 9-bromine-11,11-dimethyl-11H-benzo[a]fluorene is of interest in the field of organic chemistry and material science due to its unique structure and potential use in the synthesis of organic molecules and polymers. Its properties and reactivity make it a valuable building block for the preparation of various organic compounds with potential applications in industrial and academic research. Additionally, its structural features also make it a valuable tool in understanding the reactivity and behavior of polycyclic aromatic hydrocarbons in chemical and biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 1198396-29-0 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,9,8,3,9 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1198396-29:
(9*1)+(8*1)+(7*9)+(6*8)+(5*3)+(4*9)+(3*6)+(2*2)+(1*9)=210
210 % 10 = 0
So 1198396-29-0 is a valid CAS Registry Number.
InChI:InChI=1S/C19H15Br/c1-19(2)17-11-13(20)8-10-15(17)16-9-7-12-5-3-4-6-14(12)18(16)19/h3-11H,1-2H3
