1199773-28-8 Usage
General Description
2-Amino-3-bromo-5-chloro-4-methylpyridine is a specialized chemical compound distinguished by the presence of different functional groups. Its molecular structure includes a pyridine ring—an aromatic six-member ring with five carbon atoms and a nitrogen atom. This ring is multi-substituted with an amino group (-NH2), a bromo group (-Br), a chloro group (-Cl), and a methyl group (-CH3), each occupying specific positions on the ring structure. As a result, it is often used in various chemical reactions as a versatile building block in organic synthesis, potentially for research, pharmaceutical, and other industrial applications. However, precise information about its properties and safety measures are required when handling such chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 1199773-28-8 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,1,9,9,7,7 and 3 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1199773-28:
(9*1)+(8*1)+(7*9)+(6*9)+(5*7)+(4*7)+(3*3)+(2*2)+(1*8)=218
218 % 10 = 8
So 1199773-28-8 is a valid CAS Registry Number.
InChI:InChI=1S/C6H6BrClN2/c1-3-4(8)2-10-6(9)5(3)7/h2H,1H3,(H2,9,10)