120-06-9 Usage
Uses
Used in Organic Synthesis:
3-Phenylsydnone is used as a reagent for its ability to participate in various organic reactions, contributing to the creation of a wide range of organic compounds due to its unique structural features.
Used in Pharmaceutical Industry:
3-Phenylsydnone is utilized as a precursor in the synthesis of pharmaceuticals, leveraging its potential to be transformed into biologically active molecules for medicinal applications.
Used as a Photoinitiator in Photopolymerization:
In the field of materials science, 3-Phenylsydnone is employed as a photoinitiator to trigger photopolymerization reactions, facilitating the formation of polymers under the influence of light, which is crucial for various industrial applications, including coatings, adhesives, and 3D printing.
Used in Research and Development:
3-Phenylsydnone serves as a subject of study for scientists exploring its photochemical properties and potential uses, further expanding its applications in different areas of chemistry and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 120-06-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,2 and 0 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 120-06:
(5*1)+(4*2)+(3*0)+(2*0)+(1*6)=19
19 % 10 = 9
So 120-06-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N2O2/c11-8-6-10(9-12-8)7-4-2-1-3-5-7/h1-6H/p+1