12001-77-3 Usage
General Description
Vitamin B6, also known as pyridoxine, is a water-soluble vitamin that plays a crucial role in various bodily functions. It is essential for the metabolism of proteins, carbohydrates, and fats, and also for the production of neurotransmitters such as serotonin and dopamine. Vitamin B6 is important for the proper functioning of the nervous system, and it also supports the immune system and helps in the formation of red blood cells. Additionally, it is involved in the synthesis of hemoglobin and helps regulate blood sugar levels. Good food sources of vitamin B6 include poultry, fish, bananas, nuts, and vegetables such as spinach and potatoes. Overall, vitamin B6 is essential for maintaining overall health and well-being.
Check Digit Verification of cas no
The CAS Registry Mumber 12001-77-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,0,0 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 12001-77:
(7*1)+(6*2)+(5*0)+(4*0)+(3*1)+(2*7)+(1*7)=43
43 % 10 = 3
So 12001-77-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,10-12H,3-4H2,1H3
