120139-90-4 Usage
Uses
Used in Pharmaceutical Industry:
N-METHYL-1-QUINOLIN-5-YLMETHANAMINE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Organic Chemistry:
In the field of organic chemistry, N-METHYL-1-QUINOLIN-5-YLMETHANAMINE is utilized as a reagent or catalyst in various chemical reactions. Its presence can facilitate or enhance the synthesis of complex organic compounds, making it a valuable asset in organic synthesis processes.
Used in Drug Development:
N-METHYL-1-QUINOLIN-5-YLMETHANAMINE is employed as a precursor in the development of new drugs. Its properties enable it to be a part of innovative drug formulations, potentially leading to the creation of novel therapeutic agents.
Used in Medicinal Chemistry Research:
N-METHYL-1-QUINOLIN-5-YLMETHANAMINE is used as a research tool in medicinal chemistry to explore its potential interactions with biological targets. Understanding these interactions can provide insights into the design of new pharmaceuticals and contribute to the discovery of effective treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 120139-90-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,1,3 and 9 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 120139-90:
(8*1)+(7*2)+(6*0)+(5*1)+(4*3)+(3*9)+(2*9)+(1*0)=84
84 % 10 = 4
So 120139-90-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2/c1-12-8-9-4-2-6-11-10(9)5-3-7-13-11/h2-7,12H,8H2,1H3
120139-90-4Relevant articles and documents
HETEROCYCLIC COMPOUNDS, METHODS OF MAKING THEM AND THEIR USE IN THERAPY
-
Page 85, (2010/02/07)
In part, the present invention is directed to antibacterial compounds of formula (I) wherein A is a bicyclic heteroaryl ring or a tricyclic ring and R2 is an heterocyclic residue; L is a bond, or L is alkyl, alkenyl or cycloalkyl.