1203-86-7 Usage
Description
2,2,2',4',5'-PENTACHLOROACETOPHENONE is an organic compound with the chemical formula C8H3Cl5O. It is a derivative of acetophenone, featuring five chlorine atoms and one hydrogen atom attached to the aromatic ring. 2,2,2',4',5'-PENTACHLOROACETOPHENONE is known for its chemical stability and unique properties, making it suitable for various applications across different industries.
Uses
Used in Chemical Synthesis:
2,2,2',4',5'-PENTACHLOROACETOPHENONE is used as an intermediate in the synthesis of various organic compounds, particularly those involving the formation of carbon-chlorine bonds. Its reactivity and stability contribute to the production of desired products with high yields and purity.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,2,2',4',5'-PENTACHLOROACETOPHENONE is used as a key component in the development of new drugs and medicinal compounds. Its unique chemical structure allows for the creation of novel molecules with potential therapeutic applications.
Used in Agrochemical Industry:
2,2,2',4',5'-PENTACHLOROACETOPHENONE is utilized in the agrochemical industry for the synthesis of pesticides and other chemical products used in agriculture. Its properties make it a valuable component in the development of effective and environmentally friendly solutions for pest control and crop protection.
Used in Dye and Pigment Industry:
In the dye and pigment industry, 2,2,2',4',5'-PENTACHLOROACETOPHENONE is employed as a starting material for the production of various dyes and pigments. Its chemical structure enables the creation of vibrant and stable colorants used in a wide range of applications, including textiles, plastics, and printing inks.
Used in Polymer Industry:
2,2,2',4',5'-PENTACHLOROACETOPHENONE is also used in the polymer industry for the synthesis of polymers with specific properties, such as flame retardancy, UV resistance, and chemical stability. Its incorporation into polymer formulations can enhance the performance and durability of various plastic materials.
Check Digit Verification of cas no
The CAS Registry Mumber 1203-86-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,0 and 3 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 1203-86:
(6*1)+(5*2)+(4*0)+(3*3)+(2*8)+(1*6)=47
47 % 10 = 7
So 1203-86-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H3Cl5O/c9-4-2-6(11)5(10)1-3(4)7(14)8(12)13/h1-2,8H
1203-86-7Relevant articles and documents
Synthesis method of 2,2,2',4',5'-pentachloroacetophenone
-
Paragraph 0011-0012; 0014-0015; 0017-0018; 0020-0031, (2021/07/17)
The invention provides a synthesis method of 2,2,2',4',5'-pentachloroacetophenone. Raw materials comprise, by weight, 52-75 parts of 1,2,4-trichlorobenzene, 40-62 parts of dichloroacetyl chloride, 32-58 parts of a catalyst and 28-50 parts of water. A conventional temperature curve is broken, temperature change is utilized, and the catalyst is added at different time periods according to the proportion, so that the utilization rate of the catalyst is effectively improved, and the reaction degree is promoted to be more thorough; meanwhile, the catalyst adopts a carrier medium-Lewis acid compound, the carrier medium is prepared by utilizing the activity of microorganisms, and the catalyst is supported on a porous carrier, so that the activity of the catalyst is increased, the yield and the purity are improved, and the reaction rate and the reaction degree are prevented from being slowed down due to catalyst deposition in the reaction process; in addition, after the reaction is finished, an organic layer is washed and filtered by a high-efficiency filter membrane to further remove impurities, so that the purity of the product is effectively improved.
