120355-50-2 Usage
Uses
Used in Pharmaceutical Industry:
2,6-Dichloro-omega-nitrostyrene is used as an intermediate in the synthesis of pharmaceuticals for its ability to inhibit certain enzymes, which can contribute to the development of new drugs with specific therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical industry, 2,6-dichloro-omega-nitrostyrene is utilized as an intermediate in the production of agrochemicals, potentially aiding in the development of new pesticides or other agricultural chemicals that can enhance crop protection and yield.
Used in Organic Chemistry:
2,6-Dichloro-omega-nitrostyrene is used as a building block in organic chemistry for the creation of various other compounds. Its unique structure allows for the synthesis of a range of organic molecules with different applications in various fields, including materials science and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 120355-50-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,3,5 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 120355-50:
(8*1)+(7*2)+(6*0)+(5*3)+(4*5)+(3*5)+(2*5)+(1*0)=82
82 % 10 = 2
So 120355-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+
