120355-50-2 Usage
General Description
2,6-Dichloro-omega-nitrostyrene is a chemical compound with the molecular formula C8H5Cl2NO2. It is a yellow crystalline solid that is insoluble in water and is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. 2,6-DICHLORO-OMEGA-NITROSTYRENE is known to exhibit biological activity, particularly as an inhibitor of a certain type of enzyme. Additionally, it has potential applications in the field of organic chemistry as a building block for the creation of various other compounds. However, due to its toxic and potentially hazardous nature, proper precautions and safety measures should be taken when handling and using 2,6-dichloro-omega-nitrostyrene.
Check Digit Verification of cas no
The CAS Registry Mumber 120355-50-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,3,5 and 5 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 120355-50:
(8*1)+(7*2)+(6*0)+(5*3)+(4*5)+(3*5)+(2*5)+(1*0)=82
82 % 10 = 2
So 120355-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+
