120382-00-5 Usage
Description
(2S)-2-amino-3-[3,4-bis[(2-phenylacetyl)oxy]phenyl]propanoic acid is a complex non-proteinogenic amino acid derivative of phenylalanine with a molecular formula C30H31NO7. It features a propanoic acid group and two phenylacetyl groups, resulting in a highly modified and intricate structure. (2S)-2-amino-3-[3,4-bis[(2-phenylacetyl)oxy]phenyl]propanoic acid can be synthesized through various chemical reactions and is utilized in research and pharmaceuticals due to its unique chemical properties and potential biological activities. Careful handling and analysis are necessary in laboratory settings due to its complexity and possible stereochemistry.
Uses
Used in Pharmaceutical Industry:
(2S)-2-amino-3-[3,4-bis[(2-phenylacetyl)oxy]phenyl]propanoic acid is used as a pharmaceutical intermediate for the development of novel drugs, leveraging its unique chemical properties and potential biological activities to create new therapeutic agents.
Used in Research Applications:
In the field of scientific research, (2S)-2-amino-3-[3,4-bis[(2-phenylacetyl)oxy]phenyl]propanoic acid serves as a valuable compound for studying complex chemical reactions and exploring its potential interactions with biological systems, which can contribute to the advancement of medical and chemical knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 120382-00-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,3,8 and 2 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 120382-00:
(8*1)+(7*2)+(6*0)+(5*3)+(4*8)+(3*2)+(2*0)+(1*0)=75
75 % 10 = 5
So 120382-00-5 is a valid CAS Registry Number.
InChI:InChI=1/C25H23NO6/c26-20(25(29)30)13-19-11-12-21(31-23(27)15-17-7-3-1-4-8-17)22(14-19)32-24(28)16-18-9-5-2-6-10-18/h1-12,14,20H,13,15-16,26H2,(H,29,30)/t20-/m0/s1