1204231-59-3 Usage
General Description
5-bromo-2-chloro-4-methylpyridin-3-amine (BCMPA) is an organic compound that belongs to the class of pyridines, which hails from nitrogen-based heterocyclic compounds. This chemical is distinguished by its specific structure that includes a bromine atom at the 5 position, a chlorine atom at the 2 position, and a methyl group at the 4 position of the pyridine ring, with an amine group at the 3 position. The presence of these different functional groups can influence BCMPA's reactivity and interactions in chemical reactions, making this compound potentially useful in various applications, particularly in pharmaceutical chemistry and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 1204231-59-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,0,4,2,3 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1204231-59:
(9*1)+(8*2)+(7*0)+(6*4)+(5*2)+(4*3)+(3*1)+(2*5)+(1*9)=93
93 % 10 = 3
So 1204231-59-3 is a valid CAS Registry Number.
InChI:InChI=1S/C6H6BrClN2/c1-3-4(7)2-10-6(8)5(3)9/h2H,9H2,1H3
