1204231-59-3 Usage
Uses
Used in Pharmaceutical Chemistry:
5-bromo-2-chloro-4-methylpyridin-3-amine is used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique structure allows for the formation of new molecules with potential therapeutic properties, contributing to the development of novel drugs.
Used in Material Science:
5-bromo-2-chloro-4-methylpyridin-3-amine is used as a building block in the creation of new materials with specific properties. The presence of the bromine, chlorine, and amine groups can lead to the formation of materials with tailored characteristics, such as improved stability, reactivity, or conductivity, which can be beneficial in various industrial applications.
Used in Chemical Research:
5-bromo-2-chloro-4-methylpyridin-3-amine is used as a research compound for studying the effects of different functional groups on the reactivity and properties of pyridine-based compounds. This can help in understanding the underlying chemical mechanisms and potentially lead to the discovery of new reactions or applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1204231-59-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,0,4,2,3 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1204231-59:
(9*1)+(8*2)+(7*0)+(6*4)+(5*2)+(4*3)+(3*1)+(2*5)+(1*9)=93
93 % 10 = 3
So 1204231-59-3 is a valid CAS Registry Number.
InChI:InChI=1S/C6H6BrClN2/c1-3-4(7)2-10-6(8)5(3)9/h2H,9H2,1H3
