1204298-70-3 Usage
General Description
5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carbaldehyde is a chemical compound with the molecular formula C6H5F2N3O. It is also known as 4-(difluoromethyl)-1-methyl-1H-pyrazole-5-carbaldehyde. 5-(difluoromethyl)-1-methyl-1h-pyrazole-4-carbaldehyde is a pyrazole derivative and contains a difluoromethyl group, a methyl group, and an aldehyde functional group in its structure. It has potential applications in organic synthesis and pharmaceutical industries. 5-(difluoromethyl)-1-methyl-1h-pyrazole-4-carbaldehyde may be used as a building block in the synthesis of various pharmaceuticals and agrochemicals. Additionally, it may have potential bioactive properties that could be of interest for medicinal chemistry research. Overall, 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carbaldehyde is a versatile compound with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1204298-70-3 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,0,4,2,9 and 8 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1204298-70:
(9*1)+(8*2)+(7*0)+(6*4)+(5*2)+(4*9)+(3*8)+(2*7)+(1*0)=133
133 % 10 = 3
So 1204298-70-3 is a valid CAS Registry Number.
InChI:InChI=1S/C6H6F2N2O/c1-10-5(6(7)8)4(3-11)2-9-10/h2-3,6H,1H3