120592-98-5 Usage
Anti-fungal
NMPBSC has been studied for its ability to inhibit the growth of fungi, which could lead to the development of new antifungal drugs.
Anti-bacterial
The compound has shown potential in combating bacterial infections, making it a candidate for new antibacterial medications.
Anti-tumor
Research has indicated that NMPBSC may have anti-tumor properties, which could contribute to the development of novel cancer treatments.
Chelating agent for heavy metal ions
NMPBSC has demonstrated the ability to bind and remove heavy metal ions from various environments, which could be useful in environmental remediation and industrial processes.
Chemical structure
The compound has a unique structure that includes a phthalimide group, a methyl group, and a semicarbazone group, which contribute to its diverse range of potential applications.
Promising candidate for pharmaceutical development
Due to its multiple potential uses, NMPBSC is an area of interest for further research and development in the pharmaceutical industry.
Environmental and industrial applications
The compound's potential as a chelating agent for heavy metal ions makes it a candidate for applications in environmental remediation and industrial processes, contributing to a cleaner and safer environment.
Check Digit Verification of cas no
The CAS Registry Mumber 120592-98-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,5,9 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 120592-98:
(8*1)+(7*2)+(6*0)+(5*5)+(4*9)+(3*2)+(2*9)+(1*8)=115
115 % 10 = 5
So 120592-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N4O3/c1-8-4-3-5-10-11(8)13(20)18(12(10)19)7-6-9(2)16-17-14(15)21/h3-5H,6-7H2,1-2H3,(H3,15,17,21)/b16-9+
