1206-97-9 Usage
Main properties
1. Compound type: Chemical compound belonging to the quinolone family.
2. Molecular formula: C13H11ClN2O2.
3. Structural features: Quinoline ring, chlorine atom at the 6th position, methoxy group at the 8th position, methyl group at the 2nd position, and hydroxyl group at the 4th position.
4. Pharmaceutical properties: Potential pharmaceutical properties.
5. Antibacterial activity: Studied for its antibacterial activity.
6. Antifungal activity: Studied for its antifungal activity.
7. Promising candidate: Structure makes it a promising candidate for the development of new drugs.
Specific content
Quinoline ring with a chlorine atom at the 6th position, a methoxy group at the 8th position, a methyl group at the 2nd position, and a hydroxyl group at the 4th position gives 6-Chloro-8-methoxy-2-methylquinolin-4-ol its unique structure.
Shows potential pharmaceutical properties.
Studied for its antibacterial and antifungal activities.
Could be used as a building block for the synthesis of various pharmaceuticals.
Requires further research to fully understand its potential applications and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 1206-97-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,0 and 6 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1206-97:
(6*1)+(5*2)+(4*0)+(3*6)+(2*9)+(1*7)=59
59 % 10 = 9
So 1206-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H10ClNO2/c1-6-3-9(14)8-4-7(12)5-10(15-2)11(8)13-6/h3-5H,1-2H3,(H,13,14)
