120608-58-4 Usage
Uses
Used in Organic Synthesis:
2-Fluorobenzylmagnesium chloride is used as a reagent for the formation of carbon-carbon bonds, facilitating the synthesis of complex organic molecules.
Used in Grignard Reactions:
In the field of organic chemistry, 2-Fluorobenzylmagnesium chloride is utilized as a nucleophile in Grignard reactions. It attacks electrophilic carbon atoms, leading to the formation of new carbon-carbon bonds, which is crucial for the synthesis of various organic compounds.
Used in Pharmaceutical and Agrochemical Industries:
2-Fluorobenzylmagnesium chloride is used as a key intermediate in the production of pharmaceutical and agrochemical products. Its versatility and reactivity make it a valuable tool in the synthesis of a wide range of bioactive molecules and compounds with therapeutic and agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 120608-58-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,6,0 and 8 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 120608-58:
(8*1)+(7*2)+(6*0)+(5*6)+(4*0)+(3*8)+(2*5)+(1*8)=94
94 % 10 = 4
So 120608-58-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6F.ClH.Mg/c1-6-4-2-3-5-7(6)8;;/h2-5H,1H2;1H;/q;;+1/p-1/rC7H6ClFMg/c8-10-5-6-3-1-2-4-7(6)9/h1-4H,5H2
