120613-46-9 Usage
Uses
Used in Pharmaceutical Industry:
Tetrazolo[1,5-a]pyridine-7-carboxylic acid is used as a potential candidate for the development of new drugs due to its potential biological activities, such as antimicrobial and antitumor properties. Its unique structure and functional groups make it a promising compound for medicinal research and drug discovery.
Used in Agrochemical Industry:
In the agrochemical industry, Tetrazolo[1,5-a]pyridine-7-carboxylic acid is used as a potential component in the development of crop protection products. Its potential biological activities, such as antimicrobial properties, can be harnessed to protect crops from various pathogens and pests.
Used in Medicinal Research:
Tetrazolo[1,5-a]pyridine-7-carboxylic acid is used as a building block in organic synthesis for the development of novel compounds with potential therapeutic applications. Its unique structure and functional groups provide a foundation for the synthesis of new molecules with improved pharmacological properties.
Used in Chemical Research:
In chemical research, Tetrazolo[1,5-a]pyridine-7-carboxylic acid is used to explore its potential reactivity and properties, which can contribute to the development of new synthetic methods and the discovery of new chemical reactions. Its heterocyclic nature and functional groups make it an interesting target for further investigation and application in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 120613-46-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,6,1 and 3 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 120613-46:
(8*1)+(7*2)+(6*0)+(5*6)+(4*1)+(3*3)+(2*4)+(1*6)=79
79 % 10 = 9
So 120613-46-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O2/c11-6(12)4-1-2-10-5(3-4)7-8-9-10/h1-3H,(H,11,12)
120613-46-9Relevant academic research and scientific papers
Dual Reactivity of 1,2,3,4-Tetrazole: Manganese-Catalyzed Click Reaction and Denitrogenative Annulation
Chattopadhyay, Buddhadeb,Das, Sandip Kumar,Khatua, Hillol,Roy, Satyajit
supporting information, p. 304 - 312 (2020/10/29)
A general catalytic method using a Mn-porphyrin-based catalytic system is reported that enables two different reactions (click reaction and denitrogenative annulation) and affords two different classes of nitrogen heterocycles, 1,5-disubstituted 1,2,3-triazoles (with a pyridyl motif) and 1,2,4-triazolo-pyridines. Mechanistic investigations suggest that although the click reaction likely proceeds through an ionic mechanism, which is different from the traditional click reaction, the denitrogenative annulation reaction likely proceeds via an electrophilic metallonitrene intermediate rather than a metalloradical intermediate. Collectively, this method is highly efficient and offers several advantages over other methods. For example, this method excludes a multi-step synthesis of the N-heterocyclic molecules described and produces only environmentally benign N2 gas a by-product.
Iron(II)-Based Metalloradical Activation: Switch from Traditional Click Chemistry to Denitrogenative Annulation
Roy, Satyajit,Khatua, Hillol,Das, Sandip Kumar,Chattopadhyay, Buddhadeb
supporting information, p. 11439 - 11443 (2019/07/17)
A unique concept for the intermolecular denitrogenative annulation of 1,2,3,4-tetrazoles and alkynes was discovered by using a catalytic amount of Fe(TPP)Cl and Zn dust. The reaction precludes the traditional, more favored click reaction between an organic azide and alkynes, and instead proceeds by an unprecedented metalloradical activation. The method is anticipated to advance access to the construction of important basic nitrogen heterocycles, which will in turn enable discoveries of new drug candidates.
