120889-75-0 Usage
General Description
5-(aminomethyl)thiophene-2-carboxylic acid is a chemical compound with the molecular formula C7H9NO2S. It is a derivative of thiophene, which is a five-membered aromatic ring containing a sulfur atom. The compound contains an amino group and a carboxylic acid group, making it a versatile building block for organic synthesis. It can be used in the preparation of various pharmaceuticals, agrochemicals, and other organic compounds. The presence of the amino group makes it a potential ligand for metal complexes, and its carboxylic acid group allows for potential interactions with proteins and other biomolecules. Overall, 5-(aminomethyl)thiophene-2-carboxylic acid has the potential to be used in a wide range of applications in organic chemistry and chemical biology.
Check Digit Verification of cas no
The CAS Registry Mumber 120889-75-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,8,8 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 120889-75:
(8*1)+(7*2)+(6*0)+(5*8)+(4*8)+(3*9)+(2*7)+(1*5)=140
140 % 10 = 0
So 120889-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO2S/c7-3-4-1-2-5(10-4)6(8)9/h1-2H,3,7H2,(H,8,9)