120931-43-3 Usage
General Description
Haplodimerine is a natural product derived from marine sponges that has shown promising pharmacological properties. It has been studied for its potential as an anti-cancer agent due to its ability to inhibit the growth of cancer cells and induce apoptosis. Additionally, it has demonstrated anti-inflammatory and analgesic effects, making it a potential candidate for the development of new drugs for the treatment of various diseases. Haplodimerine has also shown antimicrobial activity, suggesting its potential use as an antibiotic. Overall, the unique chemical structure and diverse biological activities of haplodimerine make it a valuable compound for further research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 120931-43-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,0,9,3 and 1 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 120931-43:
(8*1)+(7*2)+(6*0)+(5*9)+(4*3)+(3*1)+(2*4)+(1*3)=93
93 % 10 = 3
So 120931-43-3 is a valid CAS Registry Number.
InChI:InChI=1/C28H26N2O6/c1-28(2)20-16(18-23(36-28)12-8-6-7-9-14(12)29-26(18)31)17-19-22(33-4)13-10-11-15(32-3)24(34-5)21(13)30-27(19)35-25(17)20/h6-11,16-17,20,25H,1-5H3,(H,29,31)/t16-,17+,20+,25-/m1/s1