121010-86-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Pyrrolidinone,3-amino, (R)-(9CI) is used as a building block for the production of pharmaceuticals. Its unique structure and properties make it a valuable component in the synthesis of various drugs, contributing to the development of new medications with improved efficacy and safety profiles.
Used in Organic Synthesis:
2-Pyrrolidinone,3-amino, (R)-(9CI) is used as an intermediate in organic synthesis. Its reactivity and functional groups allow it to participate in various chemical reactions, enabling the synthesis of a wide range of chemical compounds with diverse applications.
Used as a Solvent:
2-Pyrrolidinone,3-amino, (R)-(9CI) is used as a solvent in various industrial processes. Its ability to dissolve a wide range of substances makes it a useful component in the production of various products, including paints, coatings, and adhesives.
Used in Research:
2-Pyrrolidinone,3-amino, (R)-(9CI) has potential applications in research, particularly in the fields of chemistry and biology. Its unique structure and properties make it an interesting subject for studying various chemical and biological phenomena, contributing to the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 121010-86-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,0,1 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 121010-86:
(8*1)+(7*2)+(6*1)+(5*0)+(4*1)+(3*0)+(2*8)+(1*6)=54
54 % 10 = 4
So 121010-86-4 is a valid CAS Registry Number.
InChI:InChI=1/C4H8N2O/c5-3-1-2-6-4(3)7/h3H,1-2,5H2,(H,6,7)/t3-/m1/s1
121010-86-4Relevant academic research and scientific papers
ACC INHIBITORS AND USES THEREOF
-
Paragraph 0444, (2017/05/17)
The present invention provides compounds I and II useful as inhibitors of Acetyl CoA Carboxylase (ACC), compositions thereof, and methods of using the same.
N-SUBSTITUTED BENZENE SULFONAMIDES
-
Page/Page column 99, (2008/06/13)
Disclosed are N-substituted benzenesulfonamides for use intreating in treating or preventing cognitive disorders, such as Alzheimer′s Disease. Formula (I) In formula (I), R1, R2, R3, R4, R3’, R10
