121124-97-8 Usage
Uses
1. Used in Chemical Synthesis:
3-Formyl-4-methoxyphenylboronic acid is used as a reactant for Copper(I)-mediated cyanation, Suzuki-Miyaura cross-coupling reactions, and the preparation of biologically and pharmacologically active molecules. Its versatile reactivity makes it a valuable compound in the synthesis of various organic compounds.
2. Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Formyl-4-methoxyphenylboronic acid is used as a key intermediate in the synthesis of drugs with potential therapeutic applications. Its ability to participate in cross-coupling reactions allows for the creation of complex molecular structures with desired biological activities.
3. Used in Material Science:
3-Formyl-4-methoxyphenylboronic acid is also utilized in material science for the development of new materials with specific properties. Its involvement in the synthesis of biologically active molecules can lead to the creation of materials with applications in areas such as sensors, catalysts, and advanced materials for various industries.
4. Used in Research and Development:
As a reactant in various chemical reactions, 3-Formyl-4-methoxyphenylboronic acid is widely used in research and development laboratories. Its unique properties make it an essential compound for exploring new reaction pathways and developing novel synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 121124-97-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,1,2 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 121124-97:
(8*1)+(7*2)+(6*1)+(5*1)+(4*2)+(3*4)+(2*9)+(1*7)=78
78 % 10 = 8
So 121124-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BO4/c1-13-8-3-2-7(9(11)12)4-6(8)5-10/h2-5,11-12H,1H3
121124-97-8Relevant articles and documents
Synthesis of tri-and disalicylaldehydes and their chiral schiff base compounds
Liu, Hai-Bin,Wang, Mei,Wang, Ying,Wang, Lin,Sun, Li-Cheng
experimental part, p. 1074 - 1081 (2010/05/18)
A suitable procedure for convenient preparation of 1,3,5-tris(4-hydroxy-5- formylphenyl)benzene (6) was exploited via 5-bromosalicylaldehyde as starting reactant. Among the obtained products, compound 6, 4-methoxy-3- formylphenylboronic acid (9), 1,3,5-tris(4-methoxy-5-formylphenyl)benzene (10), and 4-methoxy-4'-hydroxyl-3,3'-diformyl-1,1'-diphenyl (11) had not been reported previously. Two new chiral Schiff base ligands, L1 and L2, were obtained from the tri-or disalicylaldehydes.