1211588-84-9 Usage
Uses
Used in Pharmaceutical Industry:
1H-Pyrazolo[4,3-d]pyrimidine, 7-chloro-3-phenylis used as a pharmaceutical candidate for the development of new drugs targeting various diseases, such as cancer and inflammatory disorders. Its unique chemical structure and potential pharmacological properties make it a promising compound for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 1211588-84-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,1,1,5,8 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1211588-84:
(9*1)+(8*2)+(7*1)+(6*1)+(5*5)+(4*8)+(3*8)+(2*8)+(1*4)=139
139 % 10 = 9
So 1211588-84-9 is a valid CAS Registry Number.
InChI:InChI=1S/C11H7ClN4/c12-11-10-9(13-6-14-11)8(15-16-10)7-4-2-1-3-5-7/h1-6H,(H,15,16)
