121202-20-8 Usage
Uses
Used in Pharmaceutical Industry:
[2-(3-CHLORO-PHENYL)-THIAZOL-4-YL]-METHANOL is used as a potential active pharmaceutical ingredient for its wide range of biological activities. Thiazoles, in general, are known for their presence in many pharmaceuticals, and this specific compound may offer unique properties that can be harnessed for the development of new drugs.
Used in Medicinal Chemistry Research:
[2-(3-CHLORO-PHENYL)-THIAZOL-4-YL]-METHANOL serves as a valuable compound in medicinal chemistry research, where its structure and properties can be further explored and optimized for specific therapeutic applications. Its 3-chloro-phenyl and methanol groups may provide opportunities for structural modifications to enhance its pharmacological profile.
Note: The specific applications and uses of [2-(3-CHLORO-PHENYL)-THIAZOL-4-YL]-METHANOL would depend on the results of further studies and research, as the provided materials do not detail specific applications beyond its potential in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 121202-20-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,2,0 and 2 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 121202-20:
(8*1)+(7*2)+(6*1)+(5*2)+(4*0)+(3*2)+(2*2)+(1*0)=48
48 % 10 = 8
So 121202-20-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClNOS/c11-8-3-1-2-7(4-8)10-12-9(5-13)6-14-10/h1-4,6,13H,5H2
Harmful:;
