121239-75-6 Usage
Uses
Used in Synthetic Organic Chemistry:
4-Octyloxydiphenyliodoniumhexafluoroantimonate is used as a chemical reagent for its oxidizing properties, facilitating the catalysis of reactions that involve the formation or modification of carbon-based molecules. Its application in this field is crucial for the synthesis of various organic compounds.
Used in Oxidation Reactions:
In the context of synthetic organic chemistry, 4-Octyloxydiphenyliodoniumhexafluoroantimonate is employed as an oxidizing agent to promote oxidation reactions. This is particularly important for reactions that require the introduction of oxygen atoms into organic molecules, which can lead to the formation of new functional groups and the synthesis of complex molecules.
Used in Catalyst Development:
4-Octyloxydiphenyliodoniumhexafluoroantimonate is also used in the development of catalysts that can enhance the efficiency of chemical reactions. Its role in catalysis is to lower the activation energy required for a reaction to proceed, thereby increasing the reaction rate and improving the overall yield of the desired product.
It is important to handle 4-Octyloxydiphenyliodoniumhexafluoroantimonate with care due to its potential toxicity and to follow proper safety protocols when working with this chemical compound in a laboratory setting. Detailed information on its hazards or properties may not be widely available due to its specialized use, but it is clear that it plays a significant role in the field of synthetic organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 121239-75-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,2,3 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 121239-75:
(8*1)+(7*2)+(6*1)+(5*2)+(4*3)+(3*9)+(2*7)+(1*5)=96
96 % 10 = 6
So 121239-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C20H26IO.6FH.Sb/c1-2-3-4-5-6-10-17-22-20-15-13-19(14-16-20)21-18-11-8-7-9-12-18;;;;;;;/h7-9,11-16H,2-6,10,17H2,1H3;6*1H;/q+1;;;;;;;+5/p-6/rC20H26IO.F6Sb/c1-2-3-4-5-6-10-17-22-20-15-13-19(14-16-20)21-18-11-8-7-9-12-18;1-7(2,3,4,5)6/h7-9,11-16H,2-6,10,17H2,1H3;/q+1;-1
