121263-10-3 Usage
Uses
Used in Pharmaceutical and Agrochemical Industries:
2,4-DIBROMO-3-NITROPYRIDINE is utilized as an intermediate in the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new drugs and pesticides due to its unique chemical structure and properties.
Used in Scientific Research:
2,4-DIBROMO-3-NITROPYRIDINE is employed in scientific research for studying its potential anti-cancer and anti-inflammatory properties, which could lead to the discovery of novel therapeutic agents for treating various diseases.
Used in Environmental Studies:
2,4-DIBROMO-3-NITROPYRIDINE is used as a subject of research in environmental studies, where its persistence, potential toxicity, and impact as an environmental contaminant are investigated to understand its ecological effects and develop strategies for mitigation.
Check Digit Verification of cas no
The CAS Registry Mumber 121263-10-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,2,6 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 121263-10:
(8*1)+(7*2)+(6*1)+(5*2)+(4*6)+(3*3)+(2*1)+(1*0)=73
73 % 10 = 3
So 121263-10-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H2Br2N2O2/c6-3-1-2-8-5(7)4(3)9(10)11/h1-2H
