12129-69-0 Usage
General Description
Tricarbonylmesitylenetungsten is a chemical compound that's an organometallic species of tungsten. It contains three carbonyl (CO) groups and one mesitylene group (a derivative of benzene) attached to a tungsten center. It's known to be deeply colored due to the metal-to-ligand charge transfer. Organometallic compounds like tricarbonylmesitylenetungsten are often used as catalysts or polymerization initiators in industrial chemistry due to their ability to speed up chemical reactions. They're also commonly studied due to their interesting bonding structures. The exact properties of tricarbonylmesitylenetungsten will depend on its specific arrangement and environment.
Check Digit Verification of cas no
The CAS Registry Mumber 12129-69-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,1,2 and 9 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 12129-69:
(7*1)+(6*2)+(5*1)+(4*2)+(3*9)+(2*6)+(1*9)=80
80 % 10 = 0
So 12129-69-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H12.3CHO.W/c1-7-4-8(2)6-9(3)5-7;3*1-2;/h4-6H,1-3H3;3*2H;/rC12H15O3W/c1-10-7-11(2)9-12(3)8(10)16(7,9,10,11,12,4-13,5-14)6-15/h7-9,13-15H,1-3H3
12129-69-0Relevant articles and documents
Photosubstitution of carbon monoxide in W(CO)6 by alkyne: NMR detection of thermally unstable alkyne tungsten(0) carbonyl complexes
Szymańska-Buzar, Teresa,Kern, Krystyna
, p. 74 - 83 (2007/10/03)
The NMR method has been used for the identification and characterisation of the unstable terminal alkyne complexes [W(CO)5(η2-HCCR)], [W(CO)4(η2-HCCR)2], [W(CO)(η2-HCCR)3], and v
