121459-06-1 Usage
Description
C20 Dihydroceramide, with the CAS number 121459-06-1, is a white solid compound that is useful in organic synthesis. It plays a significant role in various chemical reactions and processes, making it a valuable component in the field of chemistry.
Uses
Used in Organic Synthesis:
C20 Dihydroceramide is used as a key compound in organic synthesis for its ability to participate in various chemical reactions. Its unique structure allows it to be a versatile building block in the creation of more complex molecules, which can be utilized in different industries.
Used in Pharmaceutical Industry:
C20 Dihydroceramide is used as an intermediate in the synthesis of pharmaceutical compounds. Its chemical properties make it suitable for the development of new drugs and medications, contributing to the advancement of medical treatments.
Used in Cosmetics Industry:
In the cosmetics industry, C20 Dihydroceramide is used as an ingredient in the formulation of skincare and beauty products. Its properties may contribute to the overall effectiveness of these products, enhancing their performance and benefits for consumers.
Used in Chemical Research:
C20 Dihydroceramide is also used as a research compound in various scientific studies. Its unique characteristics make it an interesting subject for researchers to explore, potentially leading to new discoveries and innovations in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 121459-06-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,4,5 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 121459-06:
(8*1)+(7*2)+(6*1)+(5*4)+(4*5)+(3*9)+(2*0)+(1*6)=101
101 % 10 = 1
So 121459-06-1 is a valid CAS Registry Number.
InChI:InChI=1/C38H77NO3/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-34-38(42)39-36(35-40)37(41)33-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h36-37,40-41H,3-35H2,1-2H3,(H,39,42)/t36-,37+/m0/s1