121477-75-6 Usage
Description
Ethanol, 2-[(5-methyl-1H-benzimidazol-2-yl)amino](9CI) is a benzimidazole derivative with the molecular formula C10H13N3O. It is a chemical compound that has garnered attention in pharmaceutical research and drug development due to its potential biological activity. Ethanol, 2-[(5-methyl-1H-benzimidazol-2-yl)amino](9CI) is known for its ability to inhibit certain enzymes that play a role in various cellular processes, and it has been explored for its therapeutic potential in treating a spectrum of medical conditions, including cancer and infectious diseases. Its unique structure and the ongoing scientific interest in its applications make it a promising candidate for further investigation.
Uses
Used in Pharmaceutical Research and Drug Development:
Ethanol, 2-[(5-methyl-1H-benzimidazol-2-yl)amino](9CI) is utilized as a research compound for its potential to inhibit specific enzymes involved in cellular processes. Its role in this capacity is crucial for understanding the compound's mechanism of action and its potential applications in medicine.
Used in Cancer Treatment:
In the field of oncology, Ethanol, 2-[(5-methyl-1H-benzimidazol-2-yl)amino](9CI) is considered as a potential therapeutic agent. It is being studied for its ability to target and inhibit enzymes that are crucial for the growth and proliferation of cancer cells, thereby offering a new avenue for cancer treatment.
Used in Infectious Disease Treatment:
Ethanol, 2-[(5-methyl-1H-benzimidazol-2-yl)amino](9CI) is also being investigated for its potential in treating infectious diseases. Its enzyme-inhibiting properties may provide a means to combat pathogens by disrupting essential biological processes necessary for their survival and replication.
Used in Chemical Synthesis:
In the chemical industry, this benzimidazole derivative may be employed as an intermediate in the synthesis of other pharmaceuticals or chemical compounds, leveraging its unique structure to create new molecules with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 121477-75-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,4,7 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 121477-75:
(8*1)+(7*2)+(6*1)+(5*4)+(4*7)+(3*7)+(2*7)+(1*5)=116
116 % 10 = 6
So 121477-75-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3O/c1-7-2-3-8-9(6-7)13-10(12-8)11-4-5-14/h2-3,6,14H,4-5H2,1H3,(H2,11,12,13)