121556-56-7 Usage
Structure
Contains a benzoxazolium ring system
Two benzoxazole rings
Cyclopenten-1-yl group attached to a central carbon atom
Chloro substituent
Iodide salt
Conjugation
Highly conjugated
Potential Applications
Organic synthesis
Materials science
Biological probe
Interesting Properties
Structural complexity
Potential for unique physical and chemical properties
Use Cases
Research in various fields due to its complexity and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 121556-56-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,5,5 and 6 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 121556-56:
(8*1)+(7*2)+(6*1)+(5*5)+(4*5)+(3*6)+(2*5)+(1*6)=107
107 % 10 = 7
So 121556-56-7 is a valid CAS Registry Number.
InChI:InChI=1/C39H34ClN2O2.HI/c1-3-41-33-25-31(27-11-7-5-8-12-27)17-21-35(33)43-37(41)23-19-29-15-16-30(39(29)40)20-24-38-42(4-2)34-26-32(18-22-36(34)44-38)28-13-9-6-10-14-28;/h5-14,17-26H,3-4,15-16H2,1-2H3;1H/q+1;/p-1