121608-30-8 Usage
General Description
1-(2,3-Dichlorophenyl)-5-(p-fluorobenzylidene)-3-(4-(morpholino)phenyl)thiobarbituric acid is a chemical compound with a complex structure that includes a thiobarbituric acid core and various substituents. It contains two chlorophenyl groups, a p-fluorobenzylidene group, and a 4-(morpholino)phenyl group, all attached to the central thiobarbituric acid moiety. 1-(2,3-Dichlorophenyl)-5-(p-fluorobenzylidene)-3-(4-(morpholino)phenyl )thiobarbituric acid is often used in research and pharmaceutical development due to its potential pharmacological activities, such as antimicrobial, antifungal, and anticancer properties. Its unique structure allows for potential interactions with biological targets, making it a valuable compound for drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 121608-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,6,0 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 121608-30:
(8*1)+(7*2)+(6*1)+(5*6)+(4*0)+(3*8)+(2*3)+(1*0)=88
88 % 10 = 8
So 121608-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C27H20Cl2FN3O3S/c28-22-2-1-3-23(24(22)29)33-26(35)21(16-17-4-6-18(30)7-5-17)25(34)32(27(33)37)20-10-8-19(9-11-20)31-12-14-36-15-13-31/h1-11,16H,12-15H2/b21-16-