121608-34-2 Usage
General Description
The chemical "(5Z)-1-(2,5-dichlorophenyl)-3-(4-morpholin-4-ylphenyl)-5-[(3-nitrophen yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione" is an organic compound with a complex molecular structure. It consists of a diazinane ring with two sulfur atoms and various substituents such as chlorophenyl, morpholin-4-ylphenyl, and nitrophenyl groups. (5Z)-1-(2,5-dichlorophenyl)-3-(4-morpholin-4-ylphenyl)-5-[(3-nitrophen yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione may have potential biological activities or pharmaceutical applications due to its unique structure and functional groups. The presence of functional groups such as the nitro group and sulfide linkage suggests that this compound may have chemical reactivity and could potentially be used in various chemical reactions or modifications for the synthesis of other compounds. Further research and characterization of this compound are necessary to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 121608-34-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,6,0 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 121608-34:
(8*1)+(7*2)+(6*1)+(5*6)+(4*0)+(3*8)+(2*3)+(1*4)=92
92 % 10 = 2
So 121608-34-2 is a valid CAS Registry Number.
InChI:InChI=1/C27H20Cl2N4O5S/c28-18-4-9-23(29)24(16-18)32-26(35)22(15-17-2-1-3-21(14-17)33(36)37)25(34)31(27(32)39)20-7-5-19(6-8-20)30-10-12-38-13-11-30/h1-9,14-16H,10-13H2/b22-15-