121608-36-4 Usage
Description
(5Z)-1-(2,6-dichlorophenyl)-5-[(4-methoxyphenyl)methylidene]-3-(4-morpholin-4-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione is a complex organic molecule characterized by its tricyclic structure with a diazinane ring and multiple substituents. It features a sulfur atom bound to one of the nitrogen atoms in the diazinane ring and includes chlorophenyl, methoxyphenyl, and morpholin-4-ylphenyl moieties attached to the ring. This intricate structure and the presence of diverse functional groups suggest that the compound may exhibit a broad spectrum of biological activities, making it a promising candidate for pharmaceutical research and development.
Uses
Used in Pharmaceutical Research and Development:
(5Z)-1-(2,6-dichlorophenyl)-5-[(4-methoxyphenyl)methylidene]-3-(4-morpholin-4-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione is used as a potential candidate in pharmaceutical research and development due to its complex structure and diverse functional groups. Its unique molecular architecture may allow it to interact with various biological targets, potentially leading to the discovery of new therapeutic agents.
Used in Chemical Synthesis:
In the chemical synthesis industry, (5Z)-1-(2,6-dichlorophenyl)-5-[(4-methoxyphenyl)methylidene]-3-(4-morpholin-4-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione may be used as a key intermediate or building block in the synthesis of other complex organic molecules. Its versatile structure and functional groups can be exploited to create a variety of novel compounds with potential applications in different fields.
Used in Material Science:
(5Z)-1-(2,6-dichlorophenyl)-5-[(4-methoxyphenyl)methylidene]-3-(4-morp holin-4-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione's unique structural features and functional groups may also make it a candidate for use in material science, where it could be explored for its potential to influence the properties of various materials, such as polymers or coatings. Its incorporation into these materials could lead to new applications or improved performance in areas such as electronics, optics, or environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 121608-36-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,1,6,0 and 8 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 121608-36:
(8*1)+(7*2)+(6*1)+(5*6)+(4*0)+(3*8)+(2*3)+(1*6)=94
94 % 10 = 4
So 121608-36-4 is a valid CAS Registry Number.
InChI:InChI=1/C28H23Cl2N3O4S/c1-36-21-11-5-18(6-12-21)17-22-26(34)32(20-9-7-19(8-10-20)31-13-15-37-16-14-31)28(38)33(27(22)35)25-23(29)3-2-4-24(25)30/h2-12,17H,13-16H2,1H3/b22-17-