122-49-6 Usage
General Description
3-Semicarbazidobenzamide is a chemical compound that is a derivative of semicarbazide and benzamide. It is used in the field of medicinal chemistry and pharmaceutical research as a potential drug candidate due to its various biological activities. Some studies have shown that it has potential as an anticancer agent, as well as antimicrobial and antifungal properties. Research into the potential therapeutic applications of 3-semicarbazidobenzamide is ongoing, and its precise mechanisms of action and potential side effects are still being explored. Overall, this chemical has shown promise in various areas of biomedical research and could potentially be developed into a valuable therapeutic agent in the future.
Check Digit Verification of cas no
The CAS Registry Mumber 122-49-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,2 and 2 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 122-49:
(5*1)+(4*2)+(3*2)+(2*4)+(1*9)=36
36 % 10 = 6
So 122-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N4O2/c9-7(13)5-2-1-3-6(4-5)11-8(14)12-10/h1-4H,10H2,(H2,9,13)(H2,11,12,14)