122018-92-2 Usage
Description
Corticotropic release-inhibiting factor, also known as corticotropin release-inhibiting hormone (CRIH), is a neuropeptide hormone primarily produced in the hypothalamus of the brain. It plays a crucial role in regulating the body's response to stress and maintaining homeostasis by inhibiting the secretion of adrenocorticotropic hormone (ACTH) from the pituitary gland, which in turn suppresses the release of cortisol from the adrenal glands. Dysregulation of CRIH can lead to various stress-related disorders, including anxiety and depression. Additionally, research has implicated its role in regulating food intake and potential therapeutic applications for conditions such as obesity and metabolic syndrome.
Uses
Used in Pharmaceutical Industry:
Corticotropic release-inhibiting factor is used as a therapeutic agent for stress-related disorders such as anxiety and depression. Its ability to regulate the body's response to stress and maintain homeostasis makes it a promising candidate for the development of treatments for these conditions.
Used in Obesity and Metabolic Syndrome Treatment:
Corticotropic release-inhibiting factor is used as a potential treatment for obesity and metabolic syndrome due to its role in regulating food intake. By modulating the hormone's activity, it may help control appetite and promote weight loss, offering a novel approach to managing these conditions.
Used in Research:
Corticotropic release-inhibiting factor is used as a research tool to study the mechanisms underlying stress response, homeostasis, and related disorders. Understanding its role in these processes can provide insights into the development of new therapeutic strategies and interventions for various health conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 122018-92-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,0,1 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 122018-92:
(8*1)+(7*2)+(6*2)+(5*0)+(4*1)+(3*8)+(2*9)+(1*2)=82
82 % 10 = 2
So 122018-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C116H176N28O39S/c1-10-61(8)95(142-96(163)65(118)51-62-21-12-11-13-22-62)112(179)139-80(53-93(161)162)114(181)144-47-20-27-82(144)109(176)133-74(34-41-91(157)158)104(171)136-77(49-58(2)3)105(172)131-71(29-36-84(119)146)101(168)128-68(26-18-45-122-116(120)121)100(167)140-81(57-145)108(175)137-79(52-63-54-123-66-24-15-14-23-64(63)66)107(174)132-73(33-40-90(155)156)103(170)130-72(32-39-89(153)154)102(169)127-67(25-16-17-44-117)99(166)129-70(31-38-88(151)152)98(165)124-55-85(147)126-69(30-37-87(149)150)97(164)125-56-86(148)141-94(60(6)7)111(178)138-78(50-59(4)5)106(173)134-75(43-48-184-9)113(180)143-46-19-28-83(143)110(177)135-76(115(182)183)35-42-92(159)160/h11-15,21-24,54,58-61,65,67-83,94-95,123,145H,10,16-20,25-53,55-57,117-118H2,1-9H3,(H2,119,146)(H,124,165)(H,125,164)(H,126,147)(H,127,169)(H,128,168)(H,129,166)(H,130,170)(H,131,172)(H,132,174)(H,133,176)(H,134,173)(H,135,177)(H,136,171)(H,137,175)(H,138,178)(H,139,179)(H,140,167)(H,141,148)(H,142,163)(H,149,150)(H,151,152)(H,153,154)(H,155,156)(H,157