1221-99-4 Usage
General Description
2-(1H-indol-3-ylmethyl)benzoic acid, also known as a metabotropic glutamate receptor ligand, is a chemical compound with the molecular formula C18H15NO2. It is a derivative of indole and benzoic acid and exhibits pharmaceutical properties, particularly in the field of neuroscience. 2-(1H-indol-3-ylmethyl)benzoic acid is commonly used in the research and development of drugs for the treatment of various neurodegenerative disorders, such as Alzheimer's disease and Parkinson's disease. Its structure and properties make it a promising candidate for targeting specific receptors in the brain, leading to potential therapeutic applications in the future.
Check Digit Verification of cas no
The CAS Registry Mumber 1221-99-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,2 and 1 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1221-99:
(6*1)+(5*2)+(4*2)+(3*1)+(2*9)+(1*9)=54
54 % 10 = 4
So 1221-99-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO2/c18-16(19)14-7-2-1-5-11(14)9-12-10-17-15-8-4-3-6-13(12)15/h1-8,10,17H,9H2,(H,18,19)
