1221-99-4 Usage
Uses
Used in Pharmaceutical Industry:
2-(1H-indol-3-ylmethyl)benzoic acid is used as a drug candidate for the treatment of neurodegenerative disorders such as Alzheimer's disease and Parkinson's disease. Its unique structure and properties allow it to target specific receptors in the brain, potentially leading to therapeutic applications in managing these conditions.
Used in Neuroscience Research:
In the field of neuroscience, 2-(1H-indol-3-ylmethyl)benzoic acid serves as a valuable research tool for studying the mechanisms of neurodegenerative diseases and the role of metabotropic glutamate receptors in the brain. Its use in research can contribute to the development of novel therapeutic strategies and a better understanding of the underlying pathophysiology of these disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 1221-99-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,2,2 and 1 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 1221-99:
(6*1)+(5*2)+(4*2)+(3*1)+(2*9)+(1*9)=54
54 % 10 = 4
So 1221-99-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H13NO2/c18-16(19)14-7-2-1-5-11(14)9-12-10-17-15-8-4-3-6-13(12)15/h1-8,10,17H,9H2,(H,18,19)
