122367-97-9 Usage
General Description
(8-beta)-13-Bromo-1-(cyclopropylmethyl)-6,8-dimethylergoline is a chemical compound with a complex molecular structure. It belongs to the ergoline class of alkaloids and is a derivative of lysergic acid. The presence of a bromine atom and a cyclopropylmethyl group make it a potentially useful compound in medicinal chemistry and pharmaceutical research. The chemical compound's unique structure and properties may make it suitable for use as a pharmacological tool in studies related to the central nervous system and as a potential precursor for the synthesis of novel drug candidates. Further research and exploration of its pharmacological properties could lead to the development of new and improved therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 122367-97-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,3,6 and 7 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 122367-97:
(8*1)+(7*2)+(6*2)+(5*3)+(4*6)+(3*7)+(2*9)+(1*7)=119
119 % 10 = 9
So 122367-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H25BrN2/c1-12-5-16-17-7-15(21)8-19-20(17)14(6-18(16)22(2)9-12)11-23(19)10-13-3-4-13/h7-8,11-13,16,18H,3-6,9-10H2,1-2H3/t12-,16?,18-/m1/s1