122438-02-2 Usage
General Description
1-(6-Chloro-2-(4-morpholinyl)-2H-benzopyran-3-yl)ethanone is a chemical compound with the molecular formula C17H17ClNO3. It is a synthetic compound with potential pharmaceutical applications due to its structural similarity to certain natural compounds with biological activity. The presence of the chloro, morpholinyl, and benzopyran groups in its structure suggests that it may have potential as a pharmaceutical agent targeting specific biological pathways. However, further research is needed to fully understand its properties and potential applications in the field of medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 122438-02-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,4,3 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 122438-02:
(8*1)+(7*2)+(6*2)+(5*4)+(4*3)+(3*8)+(2*0)+(1*2)=92
92 % 10 = 2
So 122438-02-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H16ClNO3/c1-10(18)13-9-11-8-12(16)2-3-14(11)20-15(13)17-4-6-19-7-5-17/h2-3,8-9,15H,4-7H2,1H3
