122587-20-6 Usage
Description
Ethanone, 1-(3,4-dichloro-5-nitro-2-furanyl)-, is a chemical compound characterized by a furan ring attached to a ketone group, featuring two chlorine atoms and a nitro group on the furan ring. This structure endows it with unique chemical properties, making it a versatile building block for organic synthesis in various industries.
Uses
Used in Pharmaceutical Industry:
Ethanone, 1-(3,4-dichloro-5-nitro-2-furanyl)is utilized as a key intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs with potential therapeutic applications. Its unique chemical structure allows for the creation of diverse molecular entities with specific biological activities.
Used in Agricultural Chemical Industry:
In the agricultural sector, Ethanone, 1-(3,4-dichloro-5-nitro-2-furanyl)serves as a precursor for the production of agrochemicals, such as pesticides and herbicides. Its chemical properties enable the design of effective compounds targeting pests and weeds, enhancing crop protection and yield.
Used in Materials Science:
Ethanone, 1-(3,4-dichloro-5-nitro-2-furanyl)has potential applications in materials science as a precursor for the synthesis of functionalized polymers. Its presence in polymer structures can impart specific properties, such as enhanced stability, reactivity, or selectivity, making these polymers suitable for various high-performance applications.
Used as a Chemical Intermediate in Specialty Chemicals Production:
Due to its unique structure and chemical properties, Ethanone, 1-(3,4-dichloro-5-nitro-2-furanyl)is employed as a chemical intermediate in the production of specialty chemicals. Its versatility allows for its incorporation into a wide range of chemical products, including dyes, fragrances, and other high-value compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 122587-20-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,5,8 and 7 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 122587-20:
(8*1)+(7*2)+(6*2)+(5*5)+(4*8)+(3*7)+(2*2)+(1*0)=116
116 % 10 = 6
So 122587-20-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Cl2NO4/c1-2(10)5-3(7)4(8)6(13-5)9(11)12/h1H3