12260-67-2 Usage
General Description
CYCLOPENTENYLFERROCENE is a chemical compound with the formula C12H13Fe. It is a sandwich compound consisting of a cyclopentenyl ring bonded to a ferrocene moiety. It is notable for its electron-rich nature and the potential for use in organic synthesis and materials science. It has been studied for its potential in the development of new materials and catalysts. The compound has also been investigated for its potential use as a ligand in organometallic chemistry reactions. Overall, CYCLOPENTENYLFERROCENE has garnered interest for its unique structure and potential applications in various fields of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 12260-67-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,2,6 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 12260-67:
(7*1)+(6*2)+(5*2)+(4*6)+(3*0)+(2*6)+(1*7)=72
72 % 10 = 2
So 12260-67-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11.C5H5.Fe/c1-2-6-9(5-1)10-7-3-4-8-10;1-2-4-5-3-1;/h1-2,5-7H,3-4,8H2;1-5H;/rC15H16Fe/c1-2-7-12(6-1)14-10-5-11-15(14)16-13-8-3-4-9-13/h3-6,8-11,13,15H,1-2,7H2
