12260-67-2 Usage
Uses
Used in Organic Synthesis:
CYCLOPENTENYLFERROCENE is utilized as a key intermediate in organic synthesis for its electron-rich cyclopentenyl ring, which can participate in various chemical reactions, leading to the formation of new organic compounds.
Used in Materials Science:
In the field of materials science, CYCLOPENTENYLFERROCENE is employed as a component in the development of novel materials, leveraging its unique structure and properties to create materials with enhanced performance characteristics.
Used in Catalyst Development:
CYCLOPENTENYLFERROCENE is used as a catalyst or a catalyst precursor in various chemical reactions, taking advantage of its electron-rich nature to facilitate and enhance the reaction processes.
Used in Organometallic Chemistry:
In organometallic chemistry, CYCLOPENTENYLFERROCENE serves as a ligand, contributing to the formation of organometallic complexes with potential applications in catalysis, materials, and other chemical transformations.
Each of these applications highlights the diverse utility of CYCLOPENTENYLFERROCENE, reflecting its significance in advancing chemical research and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 12260-67-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,2,2,6 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 12260-67:
(7*1)+(6*2)+(5*2)+(4*6)+(3*0)+(2*6)+(1*7)=72
72 % 10 = 2
So 12260-67-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11.C5H5.Fe/c1-2-6-9(5-1)10-7-3-4-8-10;1-2-4-5-3-1;/h1-2,5-7H,3-4,8H2;1-5H;/rC15H16Fe/c1-2-7-12(6-1)14-10-5-11-15(14)16-13-8-3-4-9-13/h3-6,8-11,13,15H,1-2,7H2
