1228666-28-1 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
3-Iodo-1,5-naphthyridine serves as a key building block for the creation of various pharmaceuticals and agrochemicals. Its unique structure and reactivity allow for the development of new compounds with potential therapeutic and pesticidal properties.
Used in Organic Synthesis as a Reagent:
In the realm of organic synthesis, 3-Iodo-1,5-naphthyridine is utilized as a reagent that can engage in multiple types of chemical reactions. Its capacity for halogenation, cross-coupling, and nucleophilic substitution makes it instrumental in the synthesis of complex organic molecules.
Used in Medicinal and Chemical Research:
3-Iodo-1,5-naphthyridine is a significant tool in research settings, where it aids in the exploration and development of novel drugs and chemical processes. Its potential applications extend to enhancing the discovery and optimization of new chemical entities for therapeutic and agricultural use.
Check Digit Verification of cas no
The CAS Registry Mumber 1228666-28-1 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,2,2,8,6,6 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1228666-28:
(9*1)+(8*2)+(7*2)+(6*8)+(5*6)+(4*6)+(3*6)+(2*2)+(1*8)=171
171 % 10 = 1
So 1228666-28-1 is a valid CAS Registry Number.
InChI:InChI=1S/C8H5IN2/c9-6-4-8-7(11-5-6)2-1-3-10-8/h1-5H
