122991-69-9 Usage
Description
(3-methylorotato)(1,2-diaminocyclohexane)palladium (II) is a coordination complex consisting of a palladium atom bonded to a 3-methylorotato ligand and a 1,2-diaminocyclohexane ligand. Its unique structure and properties make it a promising candidate for various applications in the field of chemistry.
Uses
Used in Organic Synthesis:
(3-methylorotato)(1,2-diaminocyclohexane)palladium (II) is used as a catalyst in organic synthesis for facilitating various chemical reactions. Its ability to coordinate with different ligands allows it to act as an efficient catalyst, promoting the formation of desired products.
Used in Catalysis:
In the field of catalysis, (3-methylorotato)(1,2-diaminocyclohexane)palladium (II) is used as a catalyst to enhance the rate of chemical reactions. Its coordination properties enable it to lower the activation energy of reactions, making it a valuable component in various catalytic processes.
Used as a Reagent in Chemical Reactions:
(3-methylorotato)(1,2-diaminocyclohexane)palladium (II) is also used as a reagent in chemical reactions, particularly in the synthesis of complex organic molecules. Its unique structure allows it to participate in multiple reaction pathways, making it a versatile reagent for various chemical transformations.
Used in Research and Development:
Due to its potential applications and unique properties, (3-methylorotato)(1,2-diaminocyclohexane)palladium (II) is used in research and development for further study and exploration of its capabilities. This includes investigating its catalytic activity, stability, and potential use in new chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 122991-69-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,2,9,9 and 1 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 122991-69:
(8*1)+(7*2)+(6*2)+(5*9)+(4*9)+(3*1)+(2*6)+(1*9)=139
139 % 10 = 9
So 122991-69-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O4.C6H14N2.Pd/c1-8-4(9)2-3(5(10)11)7-6(8)12;7-5-3-1-2-4-6(5)8;/h2H,1H3,(H,7,12)(H,10,11);5-6H,1-4,7-8H2;/q;;+2/p-2
