123599-82-6 Usage
Description
[2-METHYL-1-(PROPIONYLOXY)PROPOXY](4-PHENYLBUTYL)PHOSPHORYLACETIC ACID is a complex organic phosphoric acid derivative characterized by its unique structure, which includes a propoxy group with a propionyloxy substituent, a phenylbutyl group, and an acetic acid moiety. [2-METHYL-1-(PROPIONYLOXY)PROPOXY](4-PHENYLBUTYL)PHOSPHORYLACETIC ACID may hold potential in the pharmaceutical industry due to the known biological activity and drug candidate potential of phosphoric acid derivatives.
Uses
Used in Pharmaceutical Industry:
[2-METHYL-1-(PROPIONYLOXY)PROPOXY](4-PHENYLBUTYL)PHOSPHORYLACETIC ACID is used as a potential drug candidate for its possible biological activity. [2-METHYL-1-(PROPIONYLOXY)PROPOXY](4-PHENYLBUTYL)PHOSPHORYLACETIC ACID's unique structure and the presence of a phosphoric acid group may contribute to its potential as a therapeutic agent, although further research and development are necessary to fully understand its properties and applications.
Used in Research and Development:
In the field of chemical research, [2-METHYL-1-(PROPIONYLOXY)PROPOXY](4-PHENYLBUTYL)PHOSPHORYLACETIC ACID serves as a subject of study for its complex structure and potential reactivity. Researchers may investigate its chemical properties, interactions with other compounds, and possible applications in various industries, including pharmaceuticals, materials science, and more.
Check Digit Verification of cas no
The CAS Registry Mumber 123599-82-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,5,9 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 123599-82:
(8*1)+(7*2)+(6*3)+(5*5)+(4*9)+(3*9)+(2*8)+(1*2)=146
146 % 10 = 6
So 123599-82-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H29O5P/c1-4-18(22)23-19(15(2)3)24-25(14-17(20)21)13-9-8-12-16-10-6-5-7-11-16/h5-7,10-11,15,19H,4,8-9,12-14H2,1-3H3,(H,20,21)