123604-27-3 Usage
Uses
Used in Pharmaceutical Industry:
4-Nitroindole-3-carboxylic acid is used as a building block for the synthesis of various pharmaceuticals and organic compounds. It plays a crucial role in the development of antibiotics and antiviral drugs, contributing to the advancement of medical treatments.
Used in Organic Synthesis:
As a research chemical, 4-Nitroindole-3-carboxylic acid is utilized in organic synthesis for the creation of new compounds with potential applications in various fields.
Used in Medicinal Chemistry:
4-Nitroindole-3-carboxylic acid and its derivatives are employed in medicinal chemistry for the exploration of their therapeutic and biological activities, paving the way for the discovery of novel drugs and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 123604-27-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,3,6,0 and 4 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 123604-27:
(8*1)+(7*2)+(6*3)+(5*6)+(4*0)+(3*4)+(2*2)+(1*7)=93
93 % 10 = 3
So 123604-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H6N2O4/c12-9(13)5-4-10-6-2-1-3-7(8(5)6)11(14)15/h1-4,10H,(H,12,13)
